Systematic / IUPAC Name: Methyl (2S)-1-(benzenesulfonyl)-4-(3-fluorobenzoyl)piperazine-2-carboxylate
ID: Reference12326
Other Names: NAT9-308260
Formula: C19H19FN2O5S
Methyl (2S)-4-(3-fluorobenzoyl)-1-(phenylsulfonyl)-2-piperazinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1100 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/3/2023 8:35:12 AM |
| InChI | InChI=1S/C19H19FN2O5S/c1-27-19(24)17-13-21(18(23)14-6-5-7-15(20)12-14)10-11-22(17)28(25,26)16-8-3-2-4-9-16/h2-9,12,17H,10-11,13H2,1H3/t17-/m0/s1 |
| InChI Key | CASYKONRQYAOAQ-KRWDZBQOSA-N |
| Canonical SMILES | COC(=O)C1CN(CCN1S(=O)(=O)C2=CC=CC=C2)C(=O)C3=CC(=CC=C3)F |
| CAS | |
| Splash | |
| Other Names | NAT9-308260 |