Systematic / IUPAC Name: (3R,5S)-5-[3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-(1H-indol-3-ylmethyl)pyrrolidin-3-ol
ID: Reference12342
Other Names: NAT18-349765
Formula: C21H19FN4O2
(3R,5S)-5-[3-(4-Fluorophenyl)-1,2,4-oxadiazol-5-yl]-1-(1H-indol-3-ylmethyl)-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 440 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/7/2023 11:38:24 AM |
| InChI | InChI=1S/C21H19FN4O2/c22-15-7-5-13(6-8-15)20-24-21(28-25-20)19-9-16(27)12-26(19)11-14-10-23-18-4-2-1-3-17(14)18/h1-8,10,16,19,23,27H,9,11-12H2/t16-,19+/m1/s1 |
| InChI Key | YXEPTTDEBGXXSY-APWZRJJASA-N |
| Canonical SMILES | C1C(CN(C1C2=NC(=NO2)C3=CC=C(C=C3)F)CC4=CNC5=CC=CC=C54)O |
| CAS | |
| Splash | |
| Other Names | NAT18-349765 |