Systematic / IUPAC Name: 2-[4-[[(1S,4S,6S)-3-Methyl-4-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]piperazin-1-yl]ethanol
ID: Reference12350
Other Names: NAT28-412028
Formula: C27H40N4O2
2-(4-{[(1S,4S,6S)-6-Isopropyl-3-methyl-4-{[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methyl}-2-cyclohexen-1-yl]methyl}-1-piperazinyl)ethanol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1591 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 3/7/2023 12:41:51 PM |
| InChI | InChI=1S/C27H40N4O2/c1-19(2)25-16-23(17-26-28-29-27(33-26)22-7-5-20(3)6-8-22)21(4)15-24(25)18-31-11-9-30(10-12-31)13-14-32/h5-8,15,19,23-25,32H,9-14,16-18H2,1-4H3/t23-,24-,25-/m0/s1 |
| InChI Key | VFAANDPJNGONEO-SDHOMARFSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)C2=NN=C(O2)CC3CC(C(C=C3C)CN4CCN(CC4)CCO)C(C)C |
| CAS | |
| Splash | |
| Other Names | NAT28-412028 |