Systematic / IUPAC Name: (3R,5S)-1-[[5-(Hydroxymethyl)furan-2-yl]methyl]-5-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-3-ol
ID: Reference12431
Other Names: NAT18-348923
Formula: C19H21N3O4
(3R,5S)-1-{[5-(Hydroxymethyl)-2-furyl]methyl}-5-[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1285 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/6/2023 10:24:52 AM |
| InChI | InChI=1S/C19H21N3O4/c1-12-3-2-4-13(7-12)18-20-19(26-21-18)17-8-14(24)9-22(17)10-15-5-6-16(11-23)25-15/h2-7,14,17,23-24H,8-11H2,1H3/t14-,17+/m1/s1 |
| InChI Key | GFCACLADNXYBIU-PBHICJAKSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)C2=NOC(=N2)C3CC(CN3CC4=CC=C(O4)CO)O |
| CAS | |
| Splash | |
| Other Names | NAT18-348923 |
| ChEMBL | CHEMBL3436989 |
| PubChem | 26743844 |
| ChemSpider | 21386305 |