Systematic / IUPAC Name: 5-[(6S)-5-(3-Phenylpropyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-6-yl]-3-pyrazin-2-yl-1,2,4-oxadiazole
ID: Reference12448
Other Names: NAT22-364422
Formula: C21H21N7O
(6S)-5-(3-Phenylpropyl)-6-[3-(2-pyrazinyl)-1,2,4-oxadiazol-5-yl]-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 710 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/17/2023 10:33:56 AM |
| InChI | InChI=1S/C21H21N7O/c1-2-5-15(6-3-1)7-4-10-28-13-18-16(24-14-25-18)11-19(28)21-26-20(27-29-21)17-12-22-8-9-23-17/h1-3,5-6,8-9,12,14,19H,4,7,10-11,13H2,(H,24,25)/t19-/m0/s1 |
| InChI Key | QSLSNMIBESNQPE-IBGZPJMESA-N |
| Canonical SMILES | C1C(N(CC2=C1N=CN2)CCCC3=CC=CC=C3)C4=NC(=NO4)C5=NC=CN=C5 |
| CAS | |
| Splash | |
| Other Names | NAT22-364422 |