Systematic / IUPAC Name: (3R,5S)-1-(Oxan-4-yl)-5-(3-phenyl-1,2,4-oxadiazol-5-yl)pyrrolidin-3-ol
ID: Reference12468
Other Names: NAT18-348492
Formula: C17H21N3O3
(3R,5S)-5-(3-Phenyl-1,2,4-oxadiazol-5-yl)-1-(tetrahydro-2H-pyran-4-yl)-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 761 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/4/2023 8:21:32 AM |
| InChI | InChI=1S/C17H21N3O3/c21-14-10-15(20(11-14)13-6-8-22-9-7-13)17-18-16(19-23-17)12-4-2-1-3-5-12/h1-5,13-15,21H,6-11H2/t14-,15+/m1/s1 |
| InChI Key | NYLRAWPMYPEXAN-CABCVRRESA-N |
| Canonical SMILES | C1COCCC1N2CC(CC2C3=NC(=NO3)C4=CC=CC=C4)O |
| CAS | |
| Splash | |
| Other Names | NAT18-348492 |
| ChEMBL | CHEMBL3436990 |
| PubChem | 26743574 |
| ChemSpider | 21386170 |