Systematic / IUPAC Name: N-Acetylglycine
ID: Reference1248
Other Names:
Acetamidoacetic acid;
(Acetylamino)acetic acid;
Acetylaminoacetate;
Aceturic acid;
Glycine, N-acetyl-
; more
Formula: C4H7NO3
Class: Endogenous Metabolites
N-Acetylglycine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 401 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 1:43:06 PM |
| InChI | InChI=1S/C4H7NO3/c1-3(6)5-2-4(7)8/h2H2,1H3,(H,5,6)(H,7,8) |
| InChI Key | OKJIRPAQVSHGFK-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NCC(=O)O |
| CAS | 543248 |
| Splash | |
| Other Names |
Acetamidoacetic acid; (Acetylamino)acetic acid; Acetylaminoacetate; Aceturic acid; Glycine, N-acetyl-; 2-Acetamidoacetate; Acetamidoacetate |
| ChemIDPlus | 000543248; 071240385; 023256099 |
| ChEBI | CHEBI:40410 |
| Wikipedia | Aceturic acid |
| HMDb | HMDB00532 |
| ChEMBL | CHEMBL289004 |
| PubChem | 10972 |
| ChemSpider | 10507 |
| KEGG | D03568 |