Systematic / IUPAC Name: 1-[(6aS,8S)-2-(5-Chloro-2-methoxyphenyl)-6,12-dioxo-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]-3-prop-2-enylurea
ID: Reference12517
Other Names: NAT7-330171
Formula: C24H25ClN4O4
1-Allyl-3-[(6aS,8S)-2-(5-chloro-2-methoxyphenyl)-6,12-dioxo-5,6,6a,7,8,9,10,12-octahydropyrido[2,1-c][1,4]benzodiazepin-8-yl]urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2592 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/15/2023 8:52:49 AM |
| InChI | InChI=1S/C24H25ClN4O4/c1-3-9-26-24(32)27-16-8-10-29-20(13-16)22(30)28-19-6-4-14(11-18(19)23(29)31)17-12-15(25)5-7-21(17)33-2/h3-7,11-12,16,20H,1,8-10,13H2,2H3,(H,28,30)(H2,26,27,32)/t16-,20-/m0/s1 |
| InChI Key | AOZOUOCUYGJCHH-JXFKEZNVSA-N |
| Canonical SMILES | COC1=C(C=C(C=C1)Cl)C2=CC3=C(C=C2)NC(=O)C4CC(CCN4C3=O)NC(=O)NCC=C |
| CAS | |
| Splash | |
| Other Names | NAT7-330171 |