Systematic / IUPAC Name: 3-[(4R,7S,8aS)-7-[[4-(Dimethylamino)phenyl]methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide
ID: Reference12528
Other Names: NAT23-380509
Formula: C23H37N5O2
3-[(4R,7S,8aS)-7-{[4-(Dimethylamino)benzyl]amino}-1-oxooctahydropyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 444 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/15/2023 10:36:20 AM |
| InChI | InChI=1S/C23H37N5O2/c1-5-27(6-2)22(29)12-11-20-15-25-23(30)21-13-18(16-28(20)21)24-14-17-7-9-19(10-8-17)26(3)4/h7-10,18,20-21,24H,5-6,11-16H2,1-4H3,(H,25,30)/t18-,20+,21-/m0/s1 |
| InChI Key | HBRPHZGSUJGYHX-TYPHKJRUSA-N |
| Canonical SMILES | CCN(CC)C(=O)CCC1CNC(=O)C2N1CC(C2)NCC3=CC=C(C=C3)N(C)C |
| CAS | |
| Splash | |
| Other Names | NAT23-380509 |