Systematic / IUPAC Name: 2-[(3S)-1-[(4-Methylphenyl)methyl]pyrrolidin-3-yl]-3H-benzimidazole-5-carbonitrile
ID: Reference12530
Other Names: NAT31-457762
Formula: C20H20N4
2-[(3S)-1-(4-Methylbenzyl)-3-pyrrolidinyl]-1H-benzimidazole-5-carbonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 265 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/15/2023 10:40:03 AM |
| InChI | InChI=1S/C20H20N4/c1-14-2-4-15(5-3-14)12-24-9-8-17(13-24)20-22-18-7-6-16(11-21)10-19(18)23-20/h2-7,10,17H,8-9,12-13H2,1H3,(H,22,23)/t17-/m0/s1 |
| InChI Key | ZEFNHPNTSGBRON-KRWDZBQOSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)CN2CCC(C2)C3=NC4=C(N3)C=C(C=C4)C#N |
| CAS | |
| Splash | |
| Other Names | NAT31-457762 |