Systematic / IUPAC Name: (6R)-4-[(4-Methoxyphenyl)methyl]-6-(6-methylpyridin-2-yl)oxy-1,4-oxazepane
ID: Reference12560
Other Names: NAT47-547307
Formula: C19H24N2O3
(6R)-4-(4-Methoxybenzyl)-6-[(6-methyl-2-pyridinyl)oxy]-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 735 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2023 10:35:00 AM |
| InChI | InChI=1S/C19H24N2O3/c1-15-4-3-5-19(20-15)24-18-13-21(10-11-23-14-18)12-16-6-8-17(22-2)9-7-16/h3-9,18H,10-14H2,1-2H3/t18-/m1/s1 |
| InChI Key | ZWDTYYYPZXRMNL-GOSISDBHSA-N |
| Canonical SMILES | CC1=NC(=CC=C1)OC2CN(CCOC2)CC3=CC=C(C=C3)OC |
| CAS | |
| Splash | |
| Other Names | NAT47-547307 |