Systematic / IUPAC Name: (6R)-4-[(4-Methoxyphenyl)methyl]-6-[4-(trifluoromethyl)phenoxy]-1,4-oxazepane
ID: Reference12561
Other Names: NAT47-548884
Formula: C20H22F3NO3
(6R)-4-(4-Methoxybenzyl)-6-[4-(trifluoromethyl)phenoxy]-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 294 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/29/2023 10:36:24 AM |
| InChI | InChI=1S/C20H22F3NO3/c1-25-17-6-2-15(3-7-17)12-24-10-11-26-14-19(13-24)27-18-8-4-16(5-9-18)20(21,22)23/h2-9,19H,10-14H2,1H3/t19-/m1/s1 |
| InChI Key | JUNGZYSBVRRGSH-LJQANCHMSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CN2CCOCC(C2)OC3=CC=C(C=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT47-548884 |