Systematic / IUPAC Name: Heptanedioic acid
ID: Reference1257
Other Names:
1,5-Pentanedicarboxylic acid;
6-Carboxyhexanoic acid;
1,7-Heptanedioic acid;
Heptane-1,7-dioate;
Pileric acid
Formula: C7H12O4
Class: Endogenous Metabolites
Pimelic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 248 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 12/4/2014 1:26:06 PM |
| InChI | InChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11) |
| InChI Key | WLJVNTCWHIRURA-UHFFFAOYSA-N |
| Canonical SMILES | C(CCC(=O)O)CCC(=O)O |
| CAS | 111160 |
| Splash | |
| Other Names |
1,5-Pentanedicarboxylic acid; 6-Carboxyhexanoic acid; 1,7-Heptanedioic acid; Heptane-1,7-dioate; Pileric acid; Pilerate |
| Wikipedia | Pimelic acid |
| ChemIDPlus | 000111160 |
| PubChem | 385 |
| ChEBI | CHEBI:30531 |
| KEGG | C02656 |
| ChemSpider | 376 |
| LipidsMAPs | LMFA01170051 |
| HMDb | HMDB00857 |