Systematic / IUPAC Name: (6R)-6-Methoxy-4-[(1-methylimidazol-2-yl)methyl]-1,4-oxazepane
ID: Reference12591
Other Names: NAT47-552561
Formula: C11H19N3O2
(6R)-6-Methoxy-4-[(1-methyl-1H-imidazol-2-yl)methyl]-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 405 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/19/2023 8:43:43 AM |
| InChI | InChI=1S/C11H19N3O2/c1-13-4-3-12-11(13)8-14-5-6-16-9-10(7-14)15-2/h3-4,10H,5-9H2,1-2H3/t10-/m1/s1 |
| InChI Key | OLCOCMOLHGTZKT-SNVBAGLBSA-N |
| Canonical SMILES | CN1C=CN=C1CN2CCOCC(C2)OC |
| CAS | |
| Splash | |
| Other Names | NAT47-552561 |