Systematic / IUPAC Name: (8aR)-7-(1,3-Benzodioxole-5-carbonyl)-2-[(1-methylimidazol-2-yl)methyl]-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference12598
Other Names: NAT50-555785
Formula: C19H21N5O4
(8aR)-7-(1,3-Benzodioxol-5-ylcarbonyl)-2-[(1-methyl-1H-imidazol-2-yl)methyl]hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1088 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/19/2023 9:33:19 AM |
| InChI | InChI=1S/C19H21N5O4/c1-21-5-4-20-17(21)11-23-10-14-9-22(6-7-24(14)19(23)26)18(25)13-2-3-15-16(8-13)28-12-27-15/h2-5,8,14H,6-7,9-12H2,1H3/t14-/m1/s1 |
| InChI Key | JVQMDHZIJLWUTA-CQSZACIVSA-N |
| Canonical SMILES | CN1C=CN=C1CN2CC3CN(CCN3C2=O)C(=O)C4=CC5=C(C=C4)OCO5 |
| CAS | |
| Splash | |
| Other Names | NAT50-555785 |