Systematic / IUPAC Name: 3-[[5-(Methoxymethyl)-1,2-oxazol-3-yl]methyl]-N-[(2-methoxyphenyl)methyl]oxetan-3-amine
ID: Reference12609
Other Names: NAT39-500190
Formula: C17H22N2O4
N-(2-Methoxybenzyl)-3-{[5-(methoxymethyl)-1,2-oxazol-3-yl]methyl}-3-oxetanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 769 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2023 11:50:53 AM |
| InChI | InChI=1S/C17H22N2O4/c1-20-10-15-7-14(19-23-15)8-17(11-22-12-17)18-9-13-5-3-4-6-16(13)21-2/h3-7,18H,8-12H2,1-2H3 |
| InChI Key | FCAOWNBESUROQS-UHFFFAOYSA-N |
| Canonical SMILES | COCC1=CC(=NO1)CC2(COC2)NCC3=CC=CC=C3OC |
| CAS | |
| Splash | |
| Other Names | NAT39-500190 |