Systematic / IUPAC Name: 1,2,4-Trihydroxy-9,10-anthraquinone
ID: Reference1261
Other Names:
Verantin;
1,2,4-Trihydroxyanthraquinone;
9,10-Anthracenedione, 1,2,4-trihydroxy-;
Anthraquinone, 1,2,4-trihydroxy-;
Hydroxylizaric acid
; more
Formula: C14H8O5
Class: Endogenous Metabolites Excipients/Additives/Colorants
Purpurin mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 5 |
| No. of Spectra | 3071 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | IT; FT |
| Last Modification | 4/3/2017 10:42:20 AM |
| InChI | InChI=1S/C14H8O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,15-16,19H |
| InChI Key | BBNQQADTFFCFGB-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3O)O)O |
| CAS | 81549 |
| Splash | |
| Other Names |
Verantin; 1,2,4-Trihydroxyanthraquinone; 9,10-Anthracenedione, 1,2,4-trihydroxy-; Anthraquinone, 1,2,4-trihydroxy-; Hydroxylizaric acid; Purpurine; NSC 10447 |
| ChemSpider | 6431 |
| KEGG | C10395 |
| Wikipedia | 1,2,4-Trihydroxyanthraquinone |
| ChemIDPlus | 000081549 |
| ChEMBL | CHEMBL294264 |
| ChEBI | CHEBI:8645 |
| PubChem | 6683 |