Systematic / IUPAC Name: (2S)-2-[(2R)-5,8-Dimethyl-7-propoxy-1,2,3,4-tetrahydronaphthalen-2-yl]-1-(4-hydroxypiperidin-1-yl)propan-1-one
ID: Reference12610
Other Names: NAT5-265095
Formula: C23H35NO3
(2S)-2-[(2R)-5,8-Dimethyl-7-propoxy-1,2,3,4-tetrahydro-2-naphthalenyl]-1-(4-hydroxy-1-piperidinyl)-1-propanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1320 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/23/2023 11:52:48 AM |
| InChI | InChI=1S/C23H35NO3/c1-5-12-27-22-13-15(2)20-7-6-18(14-21(20)17(22)4)16(3)23(26)24-10-8-19(25)9-11-24/h13,16,18-19,25H,5-12,14H2,1-4H3/t16-,18+/m0/s1 |
| InChI Key | ZJHXYIDJVAVKOV-FUHWJXTLSA-N |
| Canonical SMILES | CCCOC1=C(C2=C(CCC(C2)C(C)C(=O)N3CCC(CC3)O)C(=C1)C)C |
| CAS | |
| Splash | |
| Other Names | NAT5-265095 |