Systematic / IUPAC Name: (8aR)-7-(Cyclopropylmethyl)-2-methyl-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference12650
Other Names: NAT50-557220
Formula: C11H19N3O
(8aR)-7-(Cyclopropylmethyl)-2-methylhexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 330 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/10/2023 1:58:48 PM |
| InChI | InChI=1S/C11H19N3O/c1-12-7-10-8-13(6-9-2-3-9)4-5-14(10)11(12)15/h9-10H,2-8H2,1H3/t10-/m0/s1 |
| InChI Key | QVRJGXUFQCKIBZ-JTQLQIEISA-N |
| Canonical SMILES | CN1CC2CN(CCN2C1=O)CC3CC3 |
| CAS | |
| Splash | |
| Other Names | NAT50-557220 |