Systematic / IUPAC Name: (2S)-2-[(1S,4aS,7S,8S,8aS)-1-Hydroxy-4a,8-dimethyl-7-[(2-phenylacetyl)amino]-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl]-N-methyl-N-(pyridin-3-ylmethyl)propanamide
ID: Reference12651
Other Names: NAT5-397347
Formula: C30H41N3O3
(2S)-2-{(1S,7S,8S,8aS)-1-Hydroxy-4a,8-dimethyl-7-[(phenylacetyl)amino]decahydro-2-naphthalenyl}-N-methyl-N-(3-pyridinylmethyl)propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1610 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/14/2023 9:42:28 AM |
| InChI | InChI=1S/C30H41N3O3/c1-20(29(36)33(4)19-23-11-8-16-31-18-23)24-12-14-30(3)15-13-25(21(2)27(30)28(24)35)32-26(34)17-22-9-6-5-7-10-22/h5-11,16,18,20-21,24-25,27-28,35H,12-15,17,19H2,1-4H3,(H,32,34)/t20-,21+,24?,25-,27+,28-,30-/m0/s1 |
| InChI Key | BRVHSTWIXYKSJV-CFERKFDVSA-N |
| Canonical SMILES | CC1C(CCC2(C1C(C(CC2)C(C)C(=O)N(C)CC3=CN=CC=C3)O)C)NC(=O)CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT5-397347 |