Systematic / IUPAC Name:
ID: Reference12660
Other Names: NAT47-552080
Formula: C14H20N2O3
(6R)-N-Ethyl-6-phenoxy-1,4-oxazepane-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 714 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/17/2023 11:34:26 AM |
| InChI | InChI=1S/C14H20N2O3/c1-2-15-14(17)16-8-9-18-11-13(10-16)19-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3,(H,15,17)/t13-/m1/s1 |
| InChI Key | SGLDVXDXFSMIRY-CYBMUJFWSA-N |
| Canonical SMILES | CCNC(=O)N1CCOCC(C1)OC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | NAT47-552080 |