Systematic / IUPAC Name: (3S)-N-Benzyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)pyrrolidine-1-carboxamide
ID: Reference12666
Other Names: NAT31-462564
Formula: C15H18N4O2
(3S)-N-Benzyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)-1-pyrrolidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1265 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/21/2023 9:00:54 AM |
| InChI | InChI=1S/C15H18N4O2/c1-11-17-18-14(21-11)13-7-8-19(10-13)15(20)16-9-12-5-3-2-4-6-12/h2-6,13H,7-10H2,1H3,(H,16,20)/t13-/m0/s1 |
| InChI Key | BKAYQWUKYLJPQZ-ZDUSSCGKSA-N |
| Canonical SMILES | CC1=NN=C(O1)C2CCN(C2)C(=O)NCC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT31-462564 |