Systematic / IUPAC Name: (4aR,7aS)-N-Ethyl-3-oxo-4-phenyl-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide
ID: Reference12668
Other Names: NAT37-509765
Formula: C15H19N3O3
(4aR,7aS)-N-Ethyl-3-oxo-4-phenylhexahydropyrrolo[3,4-b][1,4]oxazine-6(2H)-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1325 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/21/2023 9:02:09 AM |
| InChI | InChI=1S/C15H19N3O3/c1-2-16-15(20)17-8-12-13(9-17)21-10-14(19)18(12)11-6-4-3-5-7-11/h3-7,12-13H,2,8-10H2,1H3,(H,16,20)/t12-,13+/m1/s1 |
| InChI Key | OOKHXNUFEJULGZ-OLZOCXBDSA-N |
| Canonical SMILES | CCNC(=O)N1CC2C(C1)OCC(=O)N2C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT37-509765 |