Systematic / IUPAC Name: 1,1'-[(1,8-Dioxo-1,8-octanediyl)bis(oxy)]bis(2,5-pyrrolidinedione)
ID: Reference1267
Other Names:
Bis(2,5-dioxopyrrolidin-1-yl) octanedioate;
Suberic acid bis(N-hydroxysuccinimide ester);
N-Hydroxysuccinimide suberic acid ester;
Suberic acid bis(N-succinimidyl) ester
Formula: C16H20N2O8
Disuccinimidyl suberate (DSS) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 240 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 10/17/2016 2:00:47 PM |
| InChI | InChI=1S/C16H20N2O8/c19-11-7-8-12(20)17(11)25-15(23)5-3-1-2-4-6-16(24)26-18-13(21)9-10-14(18)22/h1-10H2 |
| InChI Key | ZWIBGKZDAWNIFC-UHFFFAOYSA-N |
| Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCC(=O)ON2C(=O)CCC2=O |
| CAS | 68526603 |
| Splash | |
| Other Names |
Bis(2,5-dioxopyrrolidin-1-yl) octanedioate; Suberic acid bis(N-hydroxysuccinimide ester); N-Hydroxysuccinimide suberic acid ester; Suberic acid bis(N-succinimidyl) ester |
| ChemSpider | 90944 |
| ChemIDPlus | 068528803 |
| Wikipedia | Disuccinimidyl suberate |
| PubChem | 100658 |