Systematic / IUPAC Name: (8aS)-7-(Pyridine-3-carbonyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one
ID: Reference12675
Other Names: NAT50-554131
Formula: C12H14N4O2
(8aS)-7-(3-Pyridinylcarbonyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 265 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/24/2023 4:59:37 PM |
| InChI | InChI=1S/C12H14N4O2/c17-11(9-2-1-3-13-6-9)15-4-5-16-10(8-15)7-14-12(16)18/h1-3,6,10H,4-5,7-8H2,(H,14,18)/t10-/m0/s1 |
| InChI Key | YZWNNKZCJZRXGM-JTQLQIEISA-N |
| Canonical SMILES | C1CN2C(CNC2=O)CN1C(=O)C3=CN=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT50-554131 |