Systematic / IUPAC Name: (3R,5S)-5-(3-Benzyl-1,2,4-oxadiazol-5-yl)-1-(pyridin-3-ylmethyl)pyrrolidin-3-ol
ID: Reference12684
Other Names: NAT23-390920
Formula: C19H20N4O2
(3R,5S)-5-(3-Benzyl-1,2,4-oxadiazol-5-yl)-1-(3-pyridinylmethyl)-3-pyrrolidinol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 565 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/28/2023 6:56:17 AM |
| InChI | InChI=1S/C19H20N4O2/c24-16-10-17(23(13-16)12-15-7-4-8-20-11-15)19-21-18(22-25-19)9-14-5-2-1-3-6-14/h1-8,11,16-17,24H,9-10,12-13H2/t16-,17+/m1/s1 |
| InChI Key | MLGCTTNLIGXQRP-SJORKVTESA-N |
| Canonical SMILES | C1C(CN(C1C2=NC(=NO2)CC3=CC=CC=C3)CC4=CN=CC=C4)O |
| CAS | |
| Splash | |
| Other Names | NAT23-390920 |