Systematic / IUPAC Name: 4-Hydroxy-3,5-dimethoxybenzoic acid
ID: Reference1269
Other Names:
3,5-Dimethoxy-4-hydroxybenzoic acid;
Gallic acid 3,5-dimethyl ether;
Benzoic acid, 4-hydroxy-3,5-dimethoxy-;
3,5-Dimethoxy-4-hydroxybenzoate;
Cedar acid
Formula: C9H10O5
Class: Endogenous Metabolites
Syringic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Orbitrap ID-X with ETD_Cal Gateshead ; Q Exactive Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 4451 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | IT; FT |
| Last Modification | 12/4/2014 12:43:02 PM |
| InChI | InChI=1S/C9H10O5/c1-13-6-3-5(9(11)12)4-7(14-2)8(6)10/h3-4,10H,1-2H3,(H,11,12) |
| InChI Key | JMSVCTWVEWCHDZ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC(=CC(=C1O)OC)C(=O)O |
| CAS | 530574 |
| Splash | |
| Other Names |
3,5-Dimethoxy-4-hydroxybenzoic acid; Gallic acid 3,5-dimethyl ether; Benzoic acid, 4-hydroxy-3,5-dimethoxy-; 3,5-Dimethoxy-4-hydroxybenzoate; Cedar acid |
| PubChem | 10742 |
| Wikipedia | Syringic acid |
| ChemIDPlus | 000530574; 064887601 |
| ChemSpider | 10289 |
| KEGG | C10833 |
| ChEMBL | CHEMBL1414 |
| HMDb | HMDB02085 |