Systematic / IUPAC Name: (6R)-4-[(4-Fluorophenyl)methyl]-6-[5-(trifluoromethyl)pyridin-2-yl]oxy-1,4-oxazepane
ID: Reference12690
Other Names: NAT47-547463
Formula: C18H18F4N2O2
(6R)-4-(4-Fluorobenzyl)-6-{[5-(trifluoromethyl)-2-pyridinyl]oxy}-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 420 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/31/2023 11:12:20 AM |
| InChI | InChI=1S/C18H18F4N2O2/c19-15-4-1-13(2-5-15)10-24-7-8-25-12-16(11-24)26-17-6-3-14(9-23-17)18(20,21)22/h1-6,9,16H,7-8,10-12H2/t16-/m1/s1 |
| InChI Key | ZLYBLPSSLGRZMX-MRXNPFEDSA-N |
| Canonical SMILES | C1COCC(CN1CC2=CC=C(C=C2)F)OC3=NC=C(C=C3)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | NAT47-547463 |