Systematic / IUPAC Name:
ID: Reference12692
Other Names: NAT47-560728
Formula: C11H20N2O4
2-{[(6R)-4-Acetyl-1,4-oxazepan-6-yl]oxy}-N,N-dimethylacetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 927 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/31/2023 11:22:28 AM |
| InChI | InChI=1S/C11H20N2O4/c1-9(14)13-4-5-16-7-10(6-13)17-8-11(15)12(2)3/h10H,4-8H2,1-3H3/t10-/m1/s1 |
| InChI Key | XRBYIZNZYJURCB-SNVBAGLBSA-N |
| Canonical SMILES | CC(=O)N1CCOCC(C1)OCC(=O)N(C)C |
| CAS | |
| Splash | |
| Other Names | NAT47-560728 |
| ChemSpider | 29855725 |
| PubChem | 75367815 |
| ChEMBL | CHEMBL3437021 |