Systematic / IUPAC Name: 3,3-Bis(4-hydroxy-5-isopropyl-2-methylphenyl)-2-benzofuran-1(3H)-one
ID: Reference1270
Other Names:
1(3H)-Isobenzofuranone, 3,3-bis[4-hydroxy-2-methyl-5-(1-methylethyl)phenyl]-;
Thymophthalein
Formula: C28H30O4
Thymolphthalein mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 4 |
| No. of Spectra | 1707 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; APCI; NSI |
| Analyzers | FT |
| Last Modification | 12/4/2014 12:42:03 PM |
| InChI | InChI=1S/C28H30O4/c1-15(2)20-13-23(17(5)11-25(20)29)28(22-10-8-7-9-19(22)27(31)32-28)24-14-21(16(3)4)26(30)12-18(24)6/h7-16,29-30H,1-6H3 |
| InChI Key | LDKDGDIWEUUXSH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| CAS | 125202 |
| Splash | |
| Other Names |
1(3H)-Isobenzofuranone, 3,3-bis[4-hydroxy-2-methyl-5-(1-methylethyl)phenyl]-; Thymophthalein |
| Wikipedia | Thymolphthalein |
| ChEMBL | CHEMBL587849 |
| PubChem | 31316 |
| ChemSpider | 29054 |
| ChemIDPlus | 000125202; 062637892 |