Systematic / IUPAC Name: (8aR)-7-(1-Acetylpiperidin-4-yl)-2-(pyridin-2-ylmethyl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference12713
Other Names: NAT50-556924
Formula: C19H27N5O2
(8aR)-7-(1-Acetyl-4-piperidinyl)-2-(2-pyridinylmethyl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1771 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/15/2023 12:13:34 PM |
| InChI | InChI=1S/C19H27N5O2/c1-15(25)21-8-5-17(6-9-21)22-10-11-24-18(13-22)14-23(19(24)26)12-16-4-2-3-7-20-16/h2-4,7,17-18H,5-6,8-14H2,1H3/t18-/m1/s1 |
| InChI Key | HQGNWNWKODBVAV-GOSISDBHSA-N |
| Canonical SMILES | CC(=O)N1CCC(CC1)N2CCN3C(C2)CN(C3=O)CC4=CC=CC=N4 |
| CAS | |
| Splash | |
| Other Names | NAT50-556924 |
| ChEMBL | CHEMBL3437344 |
| ChemSpider | 29856334 |
| PubChem | 75368597 |