Systematic / IUPAC Name: 3,3',3''-Phosphinetriyltripropanoic acid
ID: Reference1273
Other Names:
3-[Bis(2-carboxyethyl)phosphanyl]propanoic acid;
TCEP
Formula: C9H15O6P
Tris(2-carboxyethyl)phosphine (TCEP) mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 296 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 10/17/2016 2:06:06 PM |
| InChI | InChI=1S/C9H15O6P/c10-7(11)1-4-16(5-2-8(12)13)6-3-9(14)15/h1-6H2,(H,10,11)(H,12,13)(H,14,15) |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-N |
| Canonical SMILES | C(CP(CCC(=O)O)CCC(=O)O)C(=O)O |
| CAS | 51805459 |
| Splash | |
| Other Names |
3-[Bis(2-carboxyethyl)phosphanyl]propanoic acid; TCEP |
| PubChem | 119411 |
| ChemSpider | 106653 |
| Wikipedia | TCEP |
| ChEMBL | CHEMBL171512 |
| ChEBI | CHEBI:63213 |
| ChemIDPlus | 005961853 |