Systematic / IUPAC Name: 3-[(4R,7S,8aS)-7-[(4-Methoxyphenyl)methylamino]-1-oxo-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]-N,N-diethylpropanamide
ID: Reference12766
Other Names: NAT23-380507
Formula: C22H34N4O3
N,N-Diethyl-3-{(4R,7S,8aS)-7-[(4-methoxybenzyl)amino]-1-oxooctahydropyrrolo[1,2-a]pyrazin-4-yl}propanamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1677 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/12/2023 1:02:05 PM |
| InChI | InChI=1S/C22H34N4O3/c1-4-25(5-2)21(27)11-8-18-14-24-22(28)20-12-17(15-26(18)20)23-13-16-6-9-19(29-3)10-7-16/h6-7,9-10,17-18,20,23H,4-5,8,11-15H2,1-3H3,(H,24,28)/t17-,18+,20-/m0/s1 |
| InChI Key | BZZCEUHIEGTFOO-NSHGMRRFSA-N |
| Canonical SMILES | CCN(CC)C(=O)CCC1CNC(=O)C2N1CC(C2)NCC3=CC=C(C=C3)OC |
| CAS | |
| Splash | |
| Other Names | NAT23-380507 |