Systematic / IUPAC Name: (3R)-4-Piperidin-4-yl-3-(5-pyridin-4-yl-1H-imidazol-2-yl)morpholine
ID: Reference12821
Other Names: NAT41-530495
Formula: C17H23N5O
(3R)-4-(4-Piperidinyl)-3-[4-(4-pyridinyl)-1H-imidazol-2-yl]morpholine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1249 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/16/2023 3:46:38 PM |
| InChI | InChI=1S/C17H23N5O/c1-5-18-6-2-13(1)15-11-20-17(21-15)16-12-23-10-9-22(16)14-3-7-19-8-4-14/h1-2,5-6,11,14,16,19H,3-4,7-10,12H2,(H,20,21)/t16-/m0/s1 |
| InChI Key | GUDAEARRYLNCOD-INIZCTEOSA-N |
| Canonical SMILES | C1CNCCC1N2CCOCC2C3=NC=C(N3)C4=CC=NC=C4 |
| CAS | |
| Splash | |
| Other Names | NAT41-530495 |