Systematic / IUPAC Name: (6R)-4-[(4-Methoxyphenyl)methyl]-6-phenylmethoxy-1,4-oxazepane
ID: Reference12844
Other Names: NAT47-560703
Formula: C20H25NO3
(6R)-6-(Benzyloxy)-4-(4-methoxybenzyl)-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 290 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/27/2023 7:37:41 AM |
| InChI | InChI=1S/C20H25NO3/c1-22-19-9-7-17(8-10-19)13-21-11-12-23-16-20(14-21)24-15-18-5-3-2-4-6-18/h2-10,20H,11-16H2,1H3/t20-/m1/s1 |
| InChI Key | QSZSWTOFCYZUEZ-HXUWFJFHSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CN2CCOCC(C2)OCC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT47-560703 |
| ChemSpider | 29855705 |
| PubChem | 75367798 |
| ChEMBL | CHEMBL3437061 |