Systematic / IUPAC Name: (6R)-4-[(4-Methoxyphenyl)methyl]-6-(3-methylbutoxy)-1,4-oxazepane
ID: Reference12845
Other Names: NAT47-560713
Formula: C18H29NO3
(6R)-4-(4-Methoxybenzyl)-6-(3-methylbutoxy)-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 285 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/27/2023 7:38:19 AM |
| InChI | InChI=1S/C18H29NO3/c1-15(2)8-10-22-18-13-19(9-11-21-14-18)12-16-4-6-17(20-3)7-5-16/h4-7,15,18H,8-14H2,1-3H3/t18-/m1/s1 |
| InChI Key | YKEAOAQWYKTPNA-GOSISDBHSA-N |
| Canonical SMILES | CC(C)CCOC1CN(CCOC1)CC2=CC=C(C=C2)OC |
| CAS | |
| Splash | |
| Other Names | NAT47-560713 |
| PubChem | 75367805 |
| ChEMBL | CHEMBL3437062 |
| ChemSpider | 29855712 |