Systematic / IUPAC Name: (1R,2R,5R,8R,9S,10R,12S)-12-Hydroxy-11-methyl-6-methylene-16-oxo-15-oxapentacyclo[9.3.2.15,8 01,10 02,8]heptadecane-9-carboxylic acid
ID: Reference1285
Other Names:
(1R,2R,5R,8R,9S,10R,11S,12S)-12-Hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1(5,8) 0(1,10) 0(2,8)]heptadecane-9-carboxylic acid;
Gibberellin A4
Formula: C19H24O5
Class: Endogenous Metabolites
Gibberellin A4 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 295 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/18/2016 6:30:04 AM |
| InChI | InChI=1S/C19H24O5/c1-9-7-18-8-10(9)3-4-11(18)19-6-5-12(20)17(2,16(23)24-19)14(19)13(18)15(21)22/h10-14,20H,1,3-8H2,2H3,(H,21,22)/t10-,11-,12+,13-,14-,17-,18+,19-/m1/s1 |
| InChI Key | RSQSQJNRHICNNH-NFMPGMCNSA-N |
| Canonical SMILES | O=C(O)C4C21CC(\C(=C)C1)CCC2C35OC(=O)C(C)(C34)C(O)CC5 |
| CAS | 468440 |
| Splash | |
| Other Names |
(1R,2R,5R,8R,9S,10R,11S,12S)-12-Hydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.1(5,8) 0(1,10) 0(2,8)]heptadecane-9-carboxylic acid; Gibberellin A4 |
| Wikipedia | Gibberellin |
| ChEBI | CHEBI:32902 |
| KEGG | C11864 |
| ChemSpider | 541256 |
| PubChem | 622971 |