Systematic / IUPAC Name: (8aS)-7-[(1-Methylindol-3-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one
ID: Reference12853
Other Names: NAT50-555933
Formula: C16H20N4O
(8aS)-7-[(1-Methyl-1H-indol-3-yl)methyl]hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 180 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/30/2023 10:49:12 AM |
| InChI | InChI=1S/C16H20N4O/c1-18-9-12(14-4-2-3-5-15(14)18)10-19-6-7-20-13(11-19)8-17-16(20)21/h2-5,9,13H,6-8,10-11H2,1H3,(H,17,21)/t13-/m0/s1 |
| InChI Key | HWKYFHZJCIXIMV-ZDUSSCGKSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CN3CCN4C(C3)CNC4=O |
| CAS | |
| Splash | |
| Other Names | NAT50-555933 |