Systematic / IUPAC Name: (8aR)-7-[(1-Methylindol-3-yl)methyl]-2-(oxan-4-yl)-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-3-one
ID: Reference12863
Other Names: NAT50-557382
Formula: C21H28N4O2
(8aR)-7-[(1-Methyl-1H-indol-3-yl)methyl]-2-(tetrahydro-2H-pyran-4-yl)hexahydroimidazo[1,5-a]pyrazin-3(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 439 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/7/2023 12:30:21 PM |
| InChI | InChI=1S/C21H28N4O2/c1-22-12-16(19-4-2-3-5-20(19)22)13-23-8-9-24-18(14-23)15-25(21(24)26)17-6-10-27-11-7-17/h2-5,12,17-18H,6-11,13-15H2,1H3/t18-/m1/s1 |
| InChI Key | PBDMIIGCHRBPDI-GOSISDBHSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CN3CCN4C(C3)CN(C4=O)C5CCOCC5 |
| CAS | |
| Splash | |
| Other Names | NAT50-557382 |