Systematic / IUPAC Name: 1-[4-[5-[(2S)-1-Benzylpyrrolidin-2-yl]-1,2,4-oxadiazol-3-yl]pyridin-2-yl]piperidine-4-carboxamide
ID: Reference12882
Other Names: NAT18-428921
Formula: C24H28N6O2
1-(4-{5-[(2S)-1-Benzyl-2-pyrrolidinyl]-1,2,4-oxadiazol-3-yl}-2-pyridinyl)-4-piperidinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 570 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/16/2023 9:07:46 AM |
| InChI | InChI=1S/C24H28N6O2/c25-22(31)18-9-13-29(14-10-18)21-15-19(8-11-26-21)23-27-24(32-28-23)20-7-4-12-30(20)16-17-5-2-1-3-6-17/h1-3,5-6,8,11,15,18,20H,4,7,9-10,12-14,16H2,(H2,25,31)/t20-/m0/s1 |
| InChI Key | DTCSAQOBIGIMHS-FQEVSTJZSA-N |
| Canonical SMILES | C1CC(N(C1)CC2=CC=CC=C2)C3=NC(=NO3)C4=CC(=NC=C4)N5CCC(CC5)C(=O)N |
| CAS | |
| Splash | |
| Other Names | NAT18-428921 |