Systematic / IUPAC Name: (3R,4R)-N-Benzyl-4-hydroxy-3-[(4-methoxybenzoyl)amino]azepane-1-carboxamide
ID: Reference12897
Other Names: NAT10-367991
Formula: C22H27N3O4
(3R,4R)-N-Benzyl-4-hydroxy-3-[(4-methoxybenzoyl)amino]-1-azepanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1470 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/23/2023 9:23:09 AM |
| InChI | InChI=1S/C22H27N3O4/c1-29-18-11-9-17(10-12-18)21(27)24-19-15-25(13-5-8-20(19)26)22(28)23-14-16-6-3-2-4-7-16/h2-4,6-7,9-12,19-20,26H,5,8,13-15H2,1H3,(H,23,28)(H,24,27)/t19-,20-/m1/s1 |
| InChI Key | CPKYZFBJYGDTFG-WOJBJXKFSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)C(=O)NC2CN(CCCC2O)C(=O)NCC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT10-367991 |