Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-(2,3-Dihydroindol-1-ylmethyl)-1-azabicyclo[2.2.2]octan-2-yl]methyl]-4-(dimethylamino)benzamide
ID: Reference12898
Other Names: NAT13-339817
Formula: C26H34N4O
N-{[(2R,4S,5R)-5-(2,3-Dihydro-1H-indol-1-ylmethyl)-1-azabicyclo[2.2.2]oct-2-yl]methyl}-4-(dimethylamino)benzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 464 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 9:23:34 AM |
| InChI | InChI=1S/C26H34N4O/c1-28(2)23-9-7-20(8-10-23)26(31)27-16-24-15-21-12-13-29(24)17-22(21)18-30-14-11-19-5-3-4-6-25(19)30/h3-10,21-22,24H,11-18H2,1-2H3,(H,27,31)/t21-,22+,24+/m0/s1 |
| InChI Key | OEENUJLMSOLJQE-WMTXJRDZSA-N |
| Canonical SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCC2CC3CCN2CC3CN4CCC5=CC=CC=C54 |
| CAS | |
| Splash | |
| Other Names | NAT13-339817 |