Systematic / IUPAC Name: (4R,7S,8aS)-4-[3-(2,3-Dihydroindol-1-yl)-3-oxopropyl]-7-[(1-methylindol-3-yl)methylamino]-3,4,6,7,8,8a-hexahydro-2H-pyrrolo[1,2-a]pyrazin-1-one
ID: Reference12901
Other Names: NAT23-379341
Formula: C28H33N5O2
(4R,7S,8aS)-4-[3-(2,3-Dihydro-1H-indol-1-yl)-3-oxopropyl]-7-{[(1-methyl-1H-indol-3-yl)methyl]amino}hexahydropyrrolo[1,2-a]pyrazin-1(2H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 949 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 1:14:49 PM |
| InChI | InChI=1S/C28H33N5O2/c1-31-17-20(23-7-3-5-9-25(23)31)15-29-21-14-26-28(35)30-16-22(33(26)18-21)10-11-27(34)32-13-12-19-6-2-4-8-24(19)32/h2-9,17,21-22,26,29H,10-16,18H2,1H3,(H,30,35)/t21-,22+,26-/m0/s1 |
| InChI Key | TZJQBZKMQWUPHA-VRUMLPLGSA-N |
| Canonical SMILES | CN1C=C(C2=CC=CC=C21)CNC3CC4C(=O)NCC(N4C3)CCC(=O)N5CCC6=CC=CC=C65 |
| CAS | |
| Splash | |
| Other Names | NAT23-379341 |