Systematic / IUPAC Name: (6R)-4-[(4-Methoxyphenyl)methyl]-6-(4-methylsulfonylphenoxy)-1,4-oxazepane
ID: Reference12903
Other Names: NAT47-552447
Formula: C20H25NO5S
(6R)-4-(4-Methoxybenzyl)-6-[4-(methylsulfonyl)phenoxy]-1,4-oxazepane mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 450 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 1:18:09 PM |
| InChI | InChI=1S/C20H25NO5S/c1-24-17-5-3-16(4-6-17)13-21-11-12-25-15-19(14-21)26-18-7-9-20(10-8-18)27(2,22)23/h3-10,19H,11-15H2,1-2H3/t19-/m1/s1 |
| InChI Key | VBONOGUPJGPDLX-LJQANCHMSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CN2CCOCC(C2)OC3=CC=C(C=C3)S(=O)(=O)C |
| CAS | |
| Splash | |
| Other Names | NAT47-552447 |