Systematic / IUPAC Name: (6R)-4-[(2-Fluorophenyl)methyl]-1,4-oxazepan-6-ol
ID: Reference12908
Other Names: NAT47-553654
Formula: C12H16FNO2
(6R)-4-(2-Fluorobenzyl)-1,4-oxazepan-6-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 210 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 1:28:11 PM |
| InChI | InChI=1S/C12H16FNO2/c13-12-4-2-1-3-10(12)7-14-5-6-16-9-11(15)8-14/h1-4,11,15H,5-9H2/t11-/m1/s1 |
| InChI Key | UTTYSGYIXCUYOS-LLVKDONJSA-N |
| Canonical SMILES | C1COCC(CN1CC2=CC=CC=C2F)O |
| CAS | |
| Splash | |
| Other Names | NAT47-553654 |