Systematic / IUPAC Name: [(6R)-6-Phenoxy-1,4-oxazepan-4-yl]-pyrazin-2-ylmethanone
ID: Reference12911
Other Names: NAT47-552075
Formula: C16H17N3O3
[(6R)-6-Phenoxy-1,4-oxazepan-4-yl](2-pyrazinyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 804 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 1:33:30 PM |
| InChI | InChI=1S/C16H17N3O3/c20-16(15-10-17-6-7-18-15)19-8-9-21-12-14(11-19)22-13-4-2-1-3-5-13/h1-7,10,14H,8-9,11-12H2/t14-/m1/s1 |
| InChI Key | PCMIKDULBGOUCL-CQSZACIVSA-N |
| Canonical SMILES | C1COCC(CN1C(=O)C2=NC=CN=C2)OC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | NAT47-552075 |