Systematic / IUPAC Name: N-(1,3-Benzodioxol-5-ylmethyl)-2-[(3R,4S)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]piperidin-4-yl]acetamide
ID: Reference12912
Other Names: NAT14-350137
Formula: C25H27N3O4
N-(1,3-Benzodioxol-5-ylmethyl)-2-{(3R,4S)-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-4-piperidinyl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 900 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/1/2023 10:06:56 AM |
| InChI | InChI=1S/C25H27N3O4/c29-25(27-14-17-6-7-22-24(10-17)31-16-30-22)12-19-8-9-26-15-20(19)11-21-13-23(32-28-21)18-4-2-1-3-5-18/h1-7,10,13,19-20,26H,8-9,11-12,14-16H2,(H,27,29)/t19-,20-/m0/s1 |
| InChI Key | UEGNGEZSLYUKSW-PMACEKPBSA-N |
| Canonical SMILES | C1CNCC(C1CC(=O)NCC2=CC3=C(C=C2)OCO3)CC4=NOC(=C4)C5=CC=CC=C5 |
| CAS | |
| Splash | |
| Other Names | NAT14-350137 |