Systematic / IUPAC Name: 2-[(3R,4S)-1-(Cyclohexylcarbamoyl)-3-[2-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]piperidin-4-yl]acetic acid
ID: Reference12913
Other Names: NAT14-336098
Formula: C27H40N4O4
[(3R,4S)-1-(Cyclohexylcarbamoyl)-3-{2-[(1R,9S)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl}-4-piperidinyl]acetic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 825 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/1/2023 10:07:51 AM |
| InChI | InChI=1S/C27H40N4O4/c32-25-8-4-7-24-22-13-19(16-31(24)25)15-29(17-22)11-9-21-18-30(12-10-20(21)14-26(33)34)27(35)28-23-5-2-1-3-6-23/h4,7-8,19-23H,1-3,5-6,9-18H2,(H,28,35)(H,33,34)/t19-,20-,21-,22+/m0/s1 |
| InChI Key | JVNLCFZTXCDOOR-MYGLTJDJSA-N |
| Canonical SMILES | C1CCC(CC1)NC(=O)N2CCC(C(C2)CCN3CC4CC(C3)C5=CC=CC(=O)N5C4)CC(=O)O |
| CAS | |
| Splash | |
| Other Names | NAT14-336098 |