Systematic / IUPAC Name:
ID: Reference12918
Other Names: 93_Me-CH-L6
Formula: C18H15NO3
(2E)-3-(3,4-Dihydroxyphenyl)-1-(1-methyl-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 3957 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 2:11:01 PM |
| InChI | InChI=1S/C18H15NO3/c1-19-11-14(13-4-2-3-5-15(13)19)16(20)8-6-12-7-9-17(21)18(22)10-12/h2-11,21-22H,1H3/b8-6+ |
| InChI Key | KAKSXCUCIXVMMT-SOFGYWHQSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 93_Me-CH-L6 |