Systematic / IUPAC Name:
ID: Reference12920
Other Names: 95_Me-CHL-7
Formula: C19H17NO3
(2E)-3-(4-Hydroxy-3-methoxyphenyl)-1-(1-methyl-1H-indol-3-yl)prop-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2217 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 12/12/2023 2:26:23 PM |
| InChI | InChI=1S/C19H17NO3/c1-20-12-15(14-5-3-4-6-16(14)20)17(21)9-7-13-8-10-18(22)19(11-13)23-2/h3-12,22H,1-2H3/b9-7+ |
| InChI Key | HSMHSKJNYPHHLP-VQHVLOKHSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 95_Me-CHL-7 |